About diphenylmethanone;3-methylheptane
diphenylmethanone;3-methylheptane (PubChem CID 174880774) has the molecular formula C21H28O
and a molecular weight of 296.45 g/mol. Its IUPAC name is diphenylmethanone;3-methylheptane.
Molecular Properties
| Compound Name | diphenylmethanone;3-methylheptane |
| PubChem CID | 174880774 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | diphenylmethanone;3-methylheptane |
| SMILES | CCCCC(C)CC.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C8H18/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4-6-7-8(3)5-2/h1-10H;8H,4-7H2,1-3H3 |
| InChIKey | ORTKDMROYFHOJU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diphenylmethanone;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;3-methylheptane?
The IUPAC name of diphenylmethanone;3-methylheptane (CID 174880774) is diphenylmethanone;3-methylheptane.
What is the SMILES notation for diphenylmethanone;3-methylheptane?
The canonical SMILES for diphenylmethanone;3-methylheptane is CCCCC(C)CC.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;3-methylheptane?
The InChIKey is ORTKDMROYFHOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C8H18/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4-6-7-8(3)5-2/h1-10H;8H,4-7H2,1-3H3.
What are the key properties of diphenylmethanone;3-methylheptane?
diphenylmethanone;3-methylheptane has a molecular weight of 296.45 g/mol, XLogP of 6.14, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;3-methylheptane is sourced from PubChem (CID 174880774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).