C21H22NO3S+ — CID 2109948
[(2R)-3-(4-benzoylphenoxy)-2-hydroxypropyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 2109948) has the molecular formula C21H22NO3S+ and a molecular weight of 368.48 g/mol. Its IUPAC name is [(2R)-3-(4-benzoylphenoxy)-2-hydroxypropyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | [(2R)-3-(4-benzoylphenoxy)-2-hydroxypropyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 2109948 |
| Molecular Formula | C21H22NO3S+ |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [(2R)-3-(4-benzoylphenoxy)-2-hydroxypropyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | O=C(c1ccccc1)c1ccc(OC[C@H](O)C[NH2+]Cc2cccs2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c23-18(13-22-14-20-7-4-12-26-20)15-25-19-10-8-17(9-11-19)21(24)16-5-2-1-3-6-16/h1-12,18,22-23H,13-15H2/p+1/t18-/m1/s1 |
| InChIKey | ZTEXIVPYNGEHRC-GOSISDBHSA-O |
| XLogP | 2.48 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |