C12H20NS+ — CID 7473498
cyclohexyl-[(3-methylthiophen-2-yl)methyl]azanium (PubChem CID 7473498) has the molecular formula C12H20NS+ and a molecular weight of 210.37 g/mol. Its IUPAC name is cyclohexyl-[(3-methylthiophen-2-yl)methyl]azanium.
| Compound Name | cyclohexyl-[(3-methylthiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 7473498 |
| Molecular Formula | C12H20NS+ |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | cyclohexyl-[(3-methylthiophen-2-yl)methyl]azanium |
| SMILES | Cc1ccsc1C[NH2+]C1CCCCC1 |
| InChI | InChI=1S/C12H19NS/c1-10-7-8-14-12(10)9-13-11-5-3-2-4-6-11/h7-8,11,13H,2-6,9H2,1H3/p+1 |
| InChIKey | NGMYCEGDKQRRPW-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |