C21H28NO2+ — CID 2199113
cyclopentyl-[3-(4-phenylmethoxyphenoxy)propyl]azanium (PubChem CID 2199113) has the molecular formula C21H28NO2+ and a molecular weight of 326.46 g/mol. Its IUPAC name is cyclopentyl-[3-(4-phenylmethoxyphenoxy)propyl]azanium.
| Compound Name | cyclopentyl-[3-(4-phenylmethoxyphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 2199113 |
| Molecular Formula | C21H28NO2+ |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | cyclopentyl-[3-(4-phenylmethoxyphenoxy)propyl]azanium |
| SMILES | c1ccc(COc2ccc(OCCC[NH2+]C3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C21H27NO2/c1-2-7-18(8-3-1)17-24-21-13-11-20(12-14-21)23-16-6-15-22-19-9-4-5-10-19/h1-3,7-8,11-14,19,22H,4-6,9-10,15-17H2/p+1 |
| InChIKey | ZUGPSGKUGNCHML-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|