C17H23ClN2O3 — CID 172719983
cyclopentyl-[2-[[5-(phenoxymethyl)-1,2-oxazol-3-yl]oxy]ethyl]azanium chloride (PubChem CID 172719983) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is cyclopentyl-[2-[[5-(phenoxymethyl)-1,2-oxazol-3-yl]oxy]ethyl]azanium chloride.
| Compound Name | cyclopentyl-[2-[[5-(phenoxymethyl)-1,2-oxazol-3-yl]oxy]ethyl]azanium chloride |
|---|---|
| PubChem CID | 172719983 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | cyclopentyl-[2-[[5-(phenoxymethyl)-1,2-oxazol-3-yl]oxy]ethyl]azanium chloride |
| SMILES | [Cl-].c1ccc(OCc2cc(OCC[NH2+]C3CCCC3)no2)cc1 |
| InChI | InChI=1S/C17H22N2O3.ClH/c1-2-8-15(9-3-1)21-13-16-12-17(19-22-16)20-11-10-18-14-6-4-5-7-14;/h1-3,8-9,12,14,18H,4-7,10-11,13H2;1H |
| InChIKey | GJJBFPLJKOBCCM-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|