C13H18ClNO — CID 2994528
N-[2-(2-chloro-3,6-dimethylphenoxy)ethyl]prop-2-en-1-amine (PubChem CID 2994528) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is N-[2-(2-chloro-3,6-dimethylphenoxy)ethyl]prop-2-en-1-amine.
| Compound Name | N-[2-(2-chloro-3,6-dimethylphenoxy)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 2994528 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[2-(2-chloro-3,6-dimethylphenoxy)ethyl]prop-2-en-1-amine |
| SMILES | C=CCNCCOc1c(C)ccc(C)c1Cl |
| InChI | InChI=1S/C13H18ClNO/c1-4-7-15-8-9-16-13-11(3)6-5-10(2)12(13)14/h4-6,15H,1,7-9H2,2-3H3 |
| InChIKey | RHECLTMVOCRXCK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|