C14H16Cl5NO — CID 63516390
N-[3-(2,3,4,5,6-pentachlorophenoxy)propyl]cyclopentanamine (PubChem CID 63516390) has the molecular formula C14H16Cl5NO and a molecular weight of 391.55 g/mol. Its IUPAC name is N-[3-(2,3,4,5,6-pentachlorophenoxy)propyl]cyclopentanamine.
| Compound Name | N-[3-(2,3,4,5,6-pentachlorophenoxy)propyl]cyclopentanamine |
|---|---|
| PubChem CID | 63516390 |
| Molecular Formula | C14H16Cl5NO |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | N-[3-(2,3,4,5,6-pentachlorophenoxy)propyl]cyclopentanamine |
| SMILES | Clc1c(Cl)c(Cl)c(OCCCNC2CCCC2)c(Cl)c1Cl |
| InChI | InChI=1S/C14H16Cl5NO/c15-9-10(16)12(18)14(13(19)11(9)17)21-7-3-6-20-8-4-1-2-5-8/h8,20H,1-7H2 |
| InChIKey | GFAGSVBEJBBQTP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|