C11H10Cl5NO — CID 55195724
N-[2-(2,3,4,5,6-pentachlorophenoxy)ethyl]cyclopropanamine (PubChem CID 55195724) has the molecular formula C11H10Cl5NO and a molecular weight of 349.47 g/mol. Its IUPAC name is N-[2-(2,3,4,5,6-pentachlorophenoxy)ethyl]cyclopropanamine.
| Compound Name | N-[2-(2,3,4,5,6-pentachlorophenoxy)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 55195724 |
| Molecular Formula | C11H10Cl5NO |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | N-[2-(2,3,4,5,6-pentachlorophenoxy)ethyl]cyclopropanamine |
| SMILES | Clc1c(Cl)c(Cl)c(OCCNC2CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl5NO/c12-6-7(13)9(15)11(10(16)8(6)14)18-4-3-17-5-1-2-5/h5,17H,1-4H2 |
| InChIKey | DJVAPHQJTWIXLC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|