C15H20Br3NO — CID 63507013
4-methyl-N-[2-(2,4,6-tribromophenoxy)ethyl]cyclohexan-1-amine (PubChem CID 63507013) has the molecular formula C15H20Br3NO and a molecular weight of 470.04 g/mol. Its IUPAC name is 4-methyl-N-[2-(2,4,6-tribromophenoxy)ethyl]cyclohexan-1-amine.
| Compound Name | 4-methyl-N-[2-(2,4,6-tribromophenoxy)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 63507013 |
| Molecular Formula | C15H20Br3NO |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 466.91 |
| IUPAC Name | 4-methyl-N-[2-(2,4,6-tribromophenoxy)ethyl]cyclohexan-1-amine |
| SMILES | CC1CCC(NCCOc2c(Br)cc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C15H20Br3NO/c1-10-2-4-12(5-3-10)19-6-7-20-15-13(17)8-11(16)9-14(15)18/h8-10,12,19H,2-7H2,1H3 |
| InChIKey | BOTAKAWVGKKFFV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|