C12H17N3O — CID 61396646
2-(3-azidopropoxy)-1,3,4-trimethylbenzene (PubChem CID 61396646) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(3-azidopropoxy)-1,3,4-trimethylbenzene.
| Compound Name | 2-(3-azidopropoxy)-1,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 61396646 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-(3-azidopropoxy)-1,3,4-trimethylbenzene |
| SMILES | Cc1ccc(C)c(OCCCN=[N+]=[N-])c1C |
| InChI | InChI=1S/C12H17N3O/c1-9-5-6-10(2)12(11(9)3)16-8-4-7-14-15-13/h5-6H,4,7-8H2,1-3H3 |
| InChIKey | WOSAYSZSVZNAFB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|