C10H13N3O — CID 61397204
1-(2-azidoethoxy)-2,3-dimethylbenzene (PubChem CID 61397204) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(2-azidoethoxy)-2,3-dimethylbenzene.
| Compound Name | 1-(2-azidoethoxy)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 61397204 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(2-azidoethoxy)-2,3-dimethylbenzene |
| SMILES | Cc1cccc(OCCN=[N+]=[N-])c1C |
| InChI | InChI=1S/C10H13N3O/c1-8-4-3-5-10(9(8)2)14-7-6-12-13-11/h3-5H,6-7H2,1-2H3 |
| InChIKey | PHHXYRRAKJYWTN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|