C11H15N3O — CID 61396645
2-(2-azidoethoxy)-1,3,4-trimethylbenzene (PubChem CID 61396645) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(2-azidoethoxy)-1,3,4-trimethylbenzene.
| Compound Name | 2-(2-azidoethoxy)-1,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 61396645 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2-(2-azidoethoxy)-1,3,4-trimethylbenzene |
| SMILES | Cc1ccc(C)c(OCCN=[N+]=[N-])c1C |
| InChI | InChI=1S/C11H15N3O/c1-8-4-5-9(2)11(10(8)3)15-7-6-13-14-12/h4-5H,6-7H2,1-3H3 |
| InChIKey | YRCSIPSTRQEXHT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|