C16H24ClNOS — CID 83940733
4-(3-chloro-2,5-dimethyl-6-propoxyphenyl)-3-methylbutanethioamide (PubChem CID 83940733) has the molecular formula C16H24ClNOS and a molecular weight of 313.89 g/mol. Its IUPAC name is 4-(3-chloro-2,5-dimethyl-6-propoxyphenyl)-3-methylbutanethioamide.
| Compound Name | 4-(3-chloro-2,5-dimethyl-6-propoxyphenyl)-3-methylbutanethioamide |
|---|---|
| PubChem CID | 83940733 |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-(3-chloro-2,5-dimethyl-6-propoxyphenyl)-3-methylbutanethioamide |
| SMILES | CCCOc1c(C)cc(Cl)c(C)c1CC(C)CC(N)=S |
| InChI | InChI=1S/C16H24ClNOS/c1-5-6-19-16-11(3)9-14(17)12(4)13(16)7-10(2)8-15(18)20/h9-10H,5-8H2,1-4H3,(H2,18,20) |
| InChIKey | AZELGQHGFJKXPQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|