C15H23NOS — CID 83940351
3-(2,6-dimethyl-4-propoxyphenyl)butanethioamide (PubChem CID 83940351) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is 3-(2,6-dimethyl-4-propoxyphenyl)butanethioamide.
| Compound Name | 3-(2,6-dimethyl-4-propoxyphenyl)butanethioamide |
|---|---|
| PubChem CID | 83940351 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-(2,6-dimethyl-4-propoxyphenyl)butanethioamide |
| SMILES | CCCOc1cc(C)c(C(C)CC(N)=S)c(C)c1 |
| InChI | InChI=1S/C15H23NOS/c1-5-6-17-13-7-10(2)15(11(3)8-13)12(4)9-14(16)18/h7-8,12H,5-6,9H2,1-4H3,(H2,16,18) |
| InChIKey | BOWPHAAUTAFOCB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|