C16H25NOS — CID 83940355
4-(2,6-dimethyl-4-propoxyphenyl)-3-methylbutanethioamide (PubChem CID 83940355) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-propoxyphenyl)-3-methylbutanethioamide.
| Compound Name | 4-(2,6-dimethyl-4-propoxyphenyl)-3-methylbutanethioamide |
|---|---|
| PubChem CID | 83940355 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4-(2,6-dimethyl-4-propoxyphenyl)-3-methylbutanethioamide |
| SMILES | CCCOc1cc(C)c(CC(C)CC(N)=S)c(C)c1 |
| InChI | InChI=1S/C16H25NOS/c1-5-6-18-14-9-12(3)15(13(4)10-14)7-11(2)8-16(17)19/h9-11H,5-8H2,1-4H3,(H2,17,19) |
| InChIKey | HKGXKKLIOGPDBF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|