C17H27NOS — CID 83939593
3-methyl-4-(2,3,6-trimethyl-4-propoxyphenyl)butanethioamide (PubChem CID 83939593) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is 3-methyl-4-(2,3,6-trimethyl-4-propoxyphenyl)butanethioamide.
| Compound Name | 3-methyl-4-(2,3,6-trimethyl-4-propoxyphenyl)butanethioamide |
|---|---|
| PubChem CID | 83939593 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-methyl-4-(2,3,6-trimethyl-4-propoxyphenyl)butanethioamide |
| SMILES | CCCOc1cc(C)c(CC(C)CC(N)=S)c(C)c1C |
| InChI | InChI=1S/C17H27NOS/c1-6-7-19-16-10-12(3)15(13(4)14(16)5)8-11(2)9-17(18)20/h10-11H,6-9H2,1-5H3,(H2,18,20) |
| InChIKey | MPCXUXQBYCBZSG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|