C16H23ClO — CID 83940767
1-chloro-2,5-dimethyl-3-[(Z)-pent-3-enyl]-4-propoxybenzene (PubChem CID 83940767) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 1-chloro-2,5-dimethyl-3-[(Z)-pent-3-enyl]-4-propoxybenzene.
| Compound Name | 1-chloro-2,5-dimethyl-3-[(Z)-pent-3-enyl]-4-propoxybenzene |
|---|---|
| PubChem CID | 83940767 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-chloro-2,5-dimethyl-3-[(Z)-pent-3-enyl]-4-propoxybenzene |
| SMILES | C/C=C\CCc1c(C)c(Cl)cc(C)c1OCCC |
| InChI | InChI=1S/C16H23ClO/c1-5-7-8-9-14-13(4)15(17)11-12(3)16(14)18-10-6-2/h5,7,11H,6,8-10H2,1-4H3/b7-5- |
| InChIKey | YLBCPEPZNLEPHQ-ALCCZGGFSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|