C16H26O3 — CID 83939528
5-(4-ethoxy-2,3,6-trimethylphenyl)pentane-2,3-diol (PubChem CID 83939528) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 5-(4-ethoxy-2,3,6-trimethylphenyl)pentane-2,3-diol.
| Compound Name | 5-(4-ethoxy-2,3,6-trimethylphenyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 83939528 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 5-(4-ethoxy-2,3,6-trimethylphenyl)pentane-2,3-diol |
| SMILES | CCOc1cc(C)c(CCC(O)C(C)O)c(C)c1C |
| InChI | InChI=1S/C16H26O3/c1-6-19-16-9-10(2)14(11(3)12(16)4)7-8-15(18)13(5)17/h9,13,15,17-18H,6-8H2,1-5H3 |
| InChIKey | POJZBEGRWSRCQC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |