C15H24ClNO — CID 83937893
5-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentan-2-amine (PubChem CID 83937893) has the molecular formula C15H24ClNO and a molecular weight of 269.82 g/mol. Its IUPAC name is 5-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentan-2-amine.
| Compound Name | 5-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentan-2-amine |
|---|---|
| PubChem CID | 83937893 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 5-(3-chloro-6-ethoxy-2,4-dimethylphenyl)pentan-2-amine |
| SMILES | CCOc1cc(C)c(Cl)c(C)c1CCCC(C)N |
| InChI | InChI=1S/C15H24ClNO/c1-5-18-14-9-10(2)15(16)12(4)13(14)8-6-7-11(3)17/h9,11H,5-8,17H2,1-4H3 |
| InChIKey | OBKICCNZMBMMAS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |