C14H11BrF3NO — CID 107097595
2-(5-bromo-2,3-difluorophenoxy)-2-(2-fluorophenyl)ethanamine (PubChem CID 107097595) has the molecular formula C14H11BrF3NO and a molecular weight of 346.15 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenoxy)-2-(2-fluorophenyl)ethanamine.
| Compound Name | 2-(5-bromo-2,3-difluorophenoxy)-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107097595 |
| Molecular Formula | C14H11BrF3NO |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenoxy)-2-(2-fluorophenyl)ethanamine |
| SMILES | NCC(Oc1cc(Br)cc(F)c1F)c1ccccc1F |
| InChI | InChI=1S/C14H11BrF3NO/c15-8-5-11(17)14(18)12(6-8)20-13(7-19)9-3-1-2-4-10(9)16/h1-6,13H,7,19H2 |
| InChIKey | AYQVTAKGMSBUOD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|