C12H10BrF2NOS — CID 63037613
2-(4-bromothiophen-2-yl)-2-(2,3-difluorophenoxy)ethanamine (PubChem CID 63037613) has the molecular formula C12H10BrF2NOS and a molecular weight of 334.19 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-2-(2,3-difluorophenoxy)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-2-(2,3-difluorophenoxy)ethanamine |
|---|---|
| PubChem CID | 63037613 |
| Molecular Formula | C12H10BrF2NOS |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-2-(2,3-difluorophenoxy)ethanamine |
| SMILES | NCC(Oc1cccc(F)c1F)c1cc(Br)cs1 |
| InChI | InChI=1S/C12H10BrF2NOS/c13-7-4-11(18-6-7)10(5-16)17-9-3-1-2-8(14)12(9)15/h1-4,6,10H,5,16H2 |
| InChIKey | RFIPKSUNHGABTC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |