C17H22BrNOS — CID 63459385
2-(4-bromothiophen-2-yl)-2-(4-tert-butyl-2-methylphenoxy)ethanamine (PubChem CID 63459385) has the molecular formula C17H22BrNOS and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-2-(4-tert-butyl-2-methylphenoxy)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-2-(4-tert-butyl-2-methylphenoxy)ethanamine |
|---|---|
| PubChem CID | 63459385 |
| Molecular Formula | C17H22BrNOS |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-2-(4-tert-butyl-2-methylphenoxy)ethanamine |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC(CN)c1cc(Br)cs1 |
| InChI | InChI=1S/C17H22BrNOS/c1-11-7-12(17(2,3)4)5-6-14(11)20-15(9-19)16-8-13(18)10-21-16/h5-8,10,15H,9,19H2,1-4H3 |
| InChIKey | NZOWJJOMXKAVIH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |