C10H12F3NO — CID 82004110
2-(2,2-difluoroethoxy)-2-(2-fluorophenyl)ethanamine (PubChem CID 82004110) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-2-(2-fluorophenyl)ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-2-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 82004110 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-2-(2-fluorophenyl)ethanamine |
| SMILES | NCC(OCC(F)F)c1ccccc1F |
| InChI | InChI=1S/C10H12F3NO/c11-8-4-2-1-3-7(8)9(5-14)15-6-10(12)13/h1-4,9-10H,5-6,14H2 |
| InChIKey | WCNPHBRNRFUYTN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |