C14H22FNO3 — CID 103401296
2-(2-fluorophenyl)-2-[3-(2-methoxyethoxy)propoxy]ethanamine (PubChem CID 103401296) has the molecular formula C14H22FNO3 and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-2-[3-(2-methoxyethoxy)propoxy]ethanamine.
| Compound Name | 2-(2-fluorophenyl)-2-[3-(2-methoxyethoxy)propoxy]ethanamine |
|---|---|
| PubChem CID | 103401296 |
| Molecular Formula | C14H22FNO3 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-(2-fluorophenyl)-2-[3-(2-methoxyethoxy)propoxy]ethanamine |
| SMILES | COCCOCCCOC(CN)c1ccccc1F |
| InChI | InChI=1S/C14H22FNO3/c1-17-9-10-18-7-4-8-19-14(11-16)12-5-2-3-6-13(12)15/h2-3,5-6,14H,4,7-11,16H2,1H3 |
| InChIKey | QAUQLXJLOZXJDI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|