C8H12ClFN2 — CID 66516599
(1S)-1-(2-fluorophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 66516599) has the molecular formula C8H12ClFN2 and a molecular weight of 190.65 g/mol. Its IUPAC name is (1S)-1-(2-fluorophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | (1S)-1-(2-fluorophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 66516599 |
| Molecular Formula | C8H12ClFN2 |
| Molecular Weight | 190.65 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (1S)-1-(2-fluorophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NC[C@@H](N)c1ccccc1F |
| InChI | InChI=1S/C8H11FN2.ClH/c9-7-4-2-1-3-6(7)8(11)5-10;/h1-4,8H,5,10-11H2;1H/t8-;/m1./s1 |
| InChIKey | LWFTZANEBRMSEL-DDWIOCJRSA-N |
| XLogP | 1.21 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.65 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |