C10H14FNO2 — CID 144615590
(2R)-4-amino-4-(2-fluorophenyl)butane-1,2-diol (PubChem CID 144615590) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is (2R)-4-amino-4-(2-fluorophenyl)butane-1,2-diol.
| Compound Name | (2R)-4-amino-4-(2-fluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 144615590 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2R)-4-amino-4-(2-fluorophenyl)butane-1,2-diol |
| SMILES | NC(C[C@@H](O)CO)c1ccccc1F |
| InChI | InChI=1S/C10H14FNO2/c11-9-4-2-1-3-8(9)10(12)5-7(14)6-13/h1-4,7,10,13-14H,5-6,12H2/t7-,10?/m1/s1 |
| InChIKey | ZLWMIMABYAPNDC-PVSHWOEXSA-N |
| XLogP | 0.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |