C11H16FNO2 — CID 60632523
3-[1-(2-fluorophenyl)ethylamino]propane-1,2-diol (PubChem CID 60632523) has the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. Its IUPAC name is 3-[1-(2-fluorophenyl)ethylamino]propane-1,2-diol.
| Compound Name | 3-[1-(2-fluorophenyl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 60632523 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-[1-(2-fluorophenyl)ethylamino]propane-1,2-diol |
| SMILES | CC(NCC(O)CO)c1ccccc1F |
| InChI | InChI=1S/C11H16FNO2/c1-8(13-6-9(15)7-14)10-4-2-3-5-11(10)12/h2-5,8-9,13-15H,6-7H2,1H3 |
| InChIKey | OMVQHHQBGSXYPT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |