C12H18FNO2 — CID 81379781
N-[(1R)-1-(2-fluorophenyl)ethyl]-2,2-dimethoxyethanamine (PubChem CID 81379781) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is N-[(1R)-1-(2-fluorophenyl)ethyl]-2,2-dimethoxyethanamine.
| Compound Name | N-[(1R)-1-(2-fluorophenyl)ethyl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 81379781 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-[(1R)-1-(2-fluorophenyl)ethyl]-2,2-dimethoxyethanamine |
| SMILES | COC(CN[C@H](C)c1ccccc1F)OC |
| InChI | InChI=1S/C12H18FNO2/c1-9(14-8-12(15-2)16-3)10-6-4-5-7-11(10)13/h4-7,9,12,14H,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | BTSSZGYRQBSMLU-SECBINFHSA-N |
| XLogP | 2.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|