C12H16F2O2 — CID 83925548
4-(2,3-difluorophenyl)hexane-1,2-diol (PubChem CID 83925548) has the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)hexane-1,2-diol.
| Compound Name | 4-(2,3-difluorophenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83925548 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-(2,3-difluorophenyl)hexane-1,2-diol |
| SMILES | CCC(CC(O)CO)c1cccc(F)c1F |
| InChI | InChI=1S/C12H16F2O2/c1-2-8(6-9(16)7-15)10-4-3-5-11(13)12(10)14/h3-5,8-9,15-16H,2,6-7H2,1H3 |
| InChIKey | SOFWHGRCTNVKGR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |