C10H13F2N — CID 130760393
2-(2,3-difluorophenyl)butan-1-amine (PubChem CID 130760393) has the molecular formula C10H13F2N and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)butan-1-amine.
| Compound Name | 2-(2,3-difluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 130760393 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(2,3-difluorophenyl)butan-1-amine |
| SMILES | CCC(CN)c1cccc(F)c1F |
| InChI | InChI=1S/C10H13F2N/c1-2-7(6-13)8-4-3-5-9(11)10(8)12/h3-5,7H,2,6,13H2,1H3 |
| InChIKey | MTZLBRFNLXMHMZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |