C14H10ClF2NOS — CID 81285477
4-(2-chloro-4-methylphenoxy)-3,5-difluorobenzenecarbothioamide (PubChem CID 81285477) has the molecular formula C14H10ClF2NOS and a molecular weight of 313.76 g/mol. Its IUPAC name is 4-(2-chloro-4-methylphenoxy)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(2-chloro-4-methylphenoxy)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81285477 |
| Molecular Formula | C14H10ClF2NOS |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 4-(2-chloro-4-methylphenoxy)-3,5-difluorobenzenecarbothioamide |
| SMILES | Cc1ccc(Oc2c(F)cc(C(N)=S)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClF2NOS/c1-7-2-3-12(9(15)4-7)19-13-10(16)5-8(14(18)20)6-11(13)17/h2-6H,1H3,(H2,18,20) |
| InChIKey | ZIBKQACEXGNLSY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|