C15H12ClF2NOS — CID 81286204
4-(4-chloro-3-ethylphenoxy)-3,5-difluorobenzenecarbothioamide (PubChem CID 81286204) has the molecular formula C15H12ClF2NOS and a molecular weight of 327.78 g/mol. Its IUPAC name is 4-(4-chloro-3-ethylphenoxy)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(4-chloro-3-ethylphenoxy)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286204 |
| Molecular Formula | C15H12ClF2NOS |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 4-(4-chloro-3-ethylphenoxy)-3,5-difluorobenzenecarbothioamide |
| SMILES | CCc1cc(Oc2c(F)cc(C(N)=S)cc2F)ccc1Cl |
| InChI | InChI=1S/C15H12ClF2NOS/c1-2-8-5-10(3-4-11(8)16)20-14-12(17)6-9(15(19)21)7-13(14)18/h3-7H,2H2,1H3,(H2,19,21) |
| InChIKey | JOTOMKXFBZXMHC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|