C13H8ClF3N2O — CID 82717295
4-(4-chloro-3-fluorophenoxy)-3,5-difluorobenzenecarboximidamide (PubChem CID 82717295) has the molecular formula C13H8ClF3N2O and a molecular weight of 300.67 g/mol. Its IUPAC name is 4-(4-chloro-3-fluorophenoxy)-3,5-difluorobenzenecarboximidamide.
| Compound Name | 4-(4-chloro-3-fluorophenoxy)-3,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 82717295 |
| Molecular Formula | C13H8ClF3N2O |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-(4-chloro-3-fluorophenoxy)-3,5-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(Oc2ccc(Cl)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C13H8ClF3N2O/c14-8-2-1-7(5-9(8)15)20-12-10(16)3-6(13(18)19)4-11(12)17/h1-5H,(H3,18,19) |
| InChIKey | KXRAMXPVTGRZAS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|