C13H8Cl2F2N2O — CID 81293557
4-(2,5-dichlorophenoxy)-3,5-difluorobenzenecarboximidamide (PubChem CID 81293557) has the molecular formula C13H8Cl2F2N2O and a molecular weight of 317.12 g/mol. Its IUPAC name is 4-(2,5-dichlorophenoxy)-3,5-difluorobenzenecarboximidamide.
| Compound Name | 4-(2,5-dichlorophenoxy)-3,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 81293557 |
| Molecular Formula | C13H8Cl2F2N2O |
| Molecular Weight | 317.12 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 4-(2,5-dichlorophenoxy)-3,5-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(Oc2cc(Cl)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C13H8Cl2F2N2O/c14-7-1-2-8(15)11(5-7)20-12-9(16)3-6(13(18)19)4-10(12)17/h1-5H,(H3,18,19) |
| InChIKey | YIXCWUOUIFPIPV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.12 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|