C12H9Cl2N3O — CID 24694773
6-(2,5-dichlorophenoxy)pyridine-3-carboximidamide (PubChem CID 24694773) has the molecular formula C12H9Cl2N3O and a molecular weight of 282.13 g/mol. Its IUPAC name is 6-(2,5-dichlorophenoxy)pyridine-3-carboximidamide.
| Compound Name | 6-(2,5-dichlorophenoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 24694773 |
| Molecular Formula | C12H9Cl2N3O |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 6-(2,5-dichlorophenoxy)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2cc(Cl)ccc2Cl)nc1 |
| InChI | InChI=1S/C12H9Cl2N3O/c13-8-2-3-9(14)10(5-8)18-11-4-1-7(6-17-11)12(15)16/h1-6H,(H3,15,16) |
| InChIKey | KGRSPAFTMYSDEY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|