C15H14F2N2O — CID 81293862
4-(2-ethylphenoxy)-3,5-difluorobenzenecarboximidamide (PubChem CID 81293862) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-(2-ethylphenoxy)-3,5-difluorobenzenecarboximidamide.
| Compound Name | 4-(2-ethylphenoxy)-3,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 81293862 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-(2-ethylphenoxy)-3,5-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(Oc2ccccc2CC)c(F)c1 |
| InChI | InChI=1S/C15H14F2N2O/c1-2-9-5-3-4-6-13(9)20-14-11(16)7-10(15(18)19)8-12(14)17/h3-8H,2H2,1H3,(H3,18,19) |
| InChIKey | DZTHLQFYENMWAE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|