C10H11BrF2OS — CID 107102524
4-(5-bromo-2,3-difluorophenoxy)butane-1-thiol (PubChem CID 107102524) has the molecular formula C10H11BrF2OS and a molecular weight of 297.16 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluorophenoxy)butane-1-thiol.
| Compound Name | 4-(5-bromo-2,3-difluorophenoxy)butane-1-thiol |
|---|---|
| PubChem CID | 107102524 |
| Molecular Formula | C10H11BrF2OS |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 4-(5-bromo-2,3-difluorophenoxy)butane-1-thiol |
| SMILES | Fc1cc(Br)cc(OCCCCS)c1F |
| InChI | InChI=1S/C10H11BrF2OS/c11-7-5-8(12)10(13)9(6-7)14-3-1-2-4-15/h5-6,15H,1-4H2 |
| InChIKey | ZWGCXOXZTRRIPB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|