C16H21BrF2O — CID 134464969
5-bromo-1,2-difluoro-3-[(4-propylcyclohexyl)methoxy]benzene (PubChem CID 134464969) has the molecular formula C16H21BrF2O and a molecular weight of 347.24 g/mol. Its IUPAC name is 5-bromo-1,2-difluoro-3-[(4-propylcyclohexyl)methoxy]benzene.
| Compound Name | 5-bromo-1,2-difluoro-3-[(4-propylcyclohexyl)methoxy]benzene |
|---|---|
| PubChem CID | 134464969 |
| Molecular Formula | C16H21BrF2O |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 5-bromo-1,2-difluoro-3-[(4-propylcyclohexyl)methoxy]benzene |
| SMILES | CCCC1CCC(COc2cc(Br)cc(F)c2F)CC1 |
| InChI | InChI=1S/C16H21BrF2O/c1-2-3-11-4-6-12(7-5-11)10-20-15-9-13(17)8-14(18)16(15)19/h8-9,11-12H,2-7,10H2,1H3 |
| InChIKey | GQIVFRSUAVFDDS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|