C25H31F5O2 — CID 59356976
7-butoxy-1,2-difluoro-3-[(4-propylcyclohexyl)methoxy]-8-(trifluoromethyl)naphthalene (PubChem CID 59356976) has the molecular formula C25H31F5O2 and a molecular weight of 458.51 g/mol. Its IUPAC name is 7-butoxy-1,2-difluoro-3-[(4-propylcyclohexyl)methoxy]-8-(trifluoromethyl)naphthalene.
| Compound Name | 7-butoxy-1,2-difluoro-3-[(4-propylcyclohexyl)methoxy]-8-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 59356976 |
| Molecular Formula | C25H31F5O2 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 7-butoxy-1,2-difluoro-3-[(4-propylcyclohexyl)methoxy]-8-(trifluoromethyl)naphthalene |
| SMILES | CCCCOc1ccc2cc(OCC3CCC(CCC)CC3)c(F)c(F)c2c1C(F)(F)F |
| InChI | InChI=1S/C25H31F5O2/c1-3-5-13-31-19-12-11-18-14-20(23(26)24(27)21(18)22(19)25(28,29)30)32-15-17-9-7-16(6-4-2)8-10-17/h11-12,14,16-17H,3-10,13,15H2,1-2H3 |
| InChIKey | YXWQMQWNZSGYCY-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|