C27H32F4O3 — CID 140909283
1,2,8,9-tetrafluoro-3-pentoxy-7-[(4-propylcyclohexyl)methoxy]dibenzofuran (PubChem CID 140909283) has the molecular formula C27H32F4O3 and a molecular weight of 480.54 g/mol. Its IUPAC name is 1,2,8,9-tetrafluoro-3-pentoxy-7-[(4-propylcyclohexyl)methoxy]dibenzofuran.
| Compound Name | 1,2,8,9-tetrafluoro-3-pentoxy-7-[(4-propylcyclohexyl)methoxy]dibenzofuran |
|---|---|
| PubChem CID | 140909283 |
| Molecular Formula | C27H32F4O3 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 1,2,8,9-tetrafluoro-3-pentoxy-7-[(4-propylcyclohexyl)methoxy]dibenzofuran |
| SMILES | CCCCCOc1cc2oc3cc(OCC4CCC(CCC)CC4)c(F)c(F)c3c2c(F)c1F |
| InChI | InChI=1S/C27H32F4O3/c1-3-5-6-12-32-20-13-18-22(26(30)24(20)28)23-19(34-18)14-21(25(29)27(23)31)33-15-17-10-8-16(7-4-2)9-11-17/h13-14,16-17H,3-12,15H2,1-2H3 |
| InChIKey | GUTLMELLDWQHDG-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|