C27H26F4O2 — CID 140909181
3-(4-butylphenyl)-1,2,8,9-tetrafluoro-7-pentoxydibenzofuran (PubChem CID 140909181) has the molecular formula C27H26F4O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 3-(4-butylphenyl)-1,2,8,9-tetrafluoro-7-pentoxydibenzofuran.
| Compound Name | 3-(4-butylphenyl)-1,2,8,9-tetrafluoro-7-pentoxydibenzofuran |
|---|---|
| PubChem CID | 140909181 |
| Molecular Formula | C27H26F4O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 3-(4-butylphenyl)-1,2,8,9-tetrafluoro-7-pentoxydibenzofuran |
| SMILES | CCCCCOc1cc2oc3cc(-c4ccc(CCCC)cc4)c(F)c(F)c3c2c(F)c1F |
| InChI | InChI=1S/C27H26F4O2/c1-3-5-7-13-32-21-15-20-23(27(31)25(21)29)22-19(33-20)14-18(24(28)26(22)30)17-11-9-16(10-12-17)8-6-4-2/h9-12,14-15H,3-8,13H2,1-2H3 |
| InChIKey | VOOJLWAMYGZYPY-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|