C25H26F4O2 — CID 140909255
3-ethoxy-1,2,8,9-tetrafluoro-7-(4-pentylcyclohexen-1-yl)dibenzofuran (PubChem CID 140909255) has the molecular formula C25H26F4O2 and a molecular weight of 434.47 g/mol. Its IUPAC name is 3-ethoxy-1,2,8,9-tetrafluoro-7-(4-pentylcyclohexen-1-yl)dibenzofuran.
| Compound Name | 3-ethoxy-1,2,8,9-tetrafluoro-7-(4-pentylcyclohexen-1-yl)dibenzofuran |
|---|---|
| PubChem CID | 140909255 |
| Molecular Formula | C25H26F4O2 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 3-ethoxy-1,2,8,9-tetrafluoro-7-(4-pentylcyclohexen-1-yl)dibenzofuran |
| SMILES | CCCCCC1CC=C(c2cc3oc4cc(OCC)c(F)c(F)c4c3c(F)c2F)CC1 |
| InChI | InChI=1S/C25H26F4O2/c1-3-5-6-7-14-8-10-15(11-9-14)16-12-17-20(24(28)22(16)26)21-18(31-17)13-19(30-4-2)23(27)25(21)29/h10,12-14H,3-9,11H2,1-2H3 |
| InChIKey | VXHXPIDZWAYDLS-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|