C10H4Br2F2N2O — CID 107099541
5-bromo-4-(5-bromo-2,3-difluorophenoxy)pyrimidine (PubChem CID 107099541) has the molecular formula C10H4Br2F2N2O and a molecular weight of 365.96 g/mol. Its IUPAC name is 5-bromo-4-(5-bromo-2,3-difluorophenoxy)pyrimidine.
| Compound Name | 5-bromo-4-(5-bromo-2,3-difluorophenoxy)pyrimidine |
|---|---|
| PubChem CID | 107099541 |
| Molecular Formula | C10H4Br2F2N2O |
| Molecular Weight | 365.96 g/mol |
| Exact Mass | 363.87 |
| IUPAC Name | 5-bromo-4-(5-bromo-2,3-difluorophenoxy)pyrimidine |
| SMILES | Fc1cc(Br)cc(Oc2ncncc2Br)c1F |
| InChI | InChI=1S/C10H4Br2F2N2O/c11-5-1-7(13)9(14)8(2-5)17-10-6(12)3-15-4-16-10/h1-4H |
| InChIKey | NMRPAAAYDPBGAH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.96 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|