C10H3BrClF2N3O3 — CID 107098107
4-(5-bromo-2,3-difluorophenoxy)-6-chloro-5-nitropyrimidine (PubChem CID 107098107) has the molecular formula C10H3BrClF2N3O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluorophenoxy)-6-chloro-5-nitropyrimidine.
| Compound Name | 4-(5-bromo-2,3-difluorophenoxy)-6-chloro-5-nitropyrimidine |
|---|---|
| PubChem CID | 107098107 |
| Molecular Formula | C10H3BrClF2N3O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 364.90 |
| IUPAC Name | 4-(5-bromo-2,3-difluorophenoxy)-6-chloro-5-nitropyrimidine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C10H3BrClF2N3O3/c11-4-1-5(13)7(14)6(2-4)20-10-8(17(18)19)9(12)15-3-16-10/h1-3H |
| InChIKey | ZYENUABYNWFAEG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|