C10H4ClF2N3O3 — CID 55169851
4-chloro-6-(2,5-difluorophenoxy)-5-nitropyrimidine (PubChem CID 55169851) has the molecular formula C10H4ClF2N3O3 and a molecular weight of 287.61 g/mol. Its IUPAC name is 4-chloro-6-(2,5-difluorophenoxy)-5-nitropyrimidine.
| Compound Name | 4-chloro-6-(2,5-difluorophenoxy)-5-nitropyrimidine |
|---|---|
| PubChem CID | 55169851 |
| Molecular Formula | C10H4ClF2N3O3 |
| Molecular Weight | 287.61 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 4-chloro-6-(2,5-difluorophenoxy)-5-nitropyrimidine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1Oc1cc(F)ccc1F |
| InChI | InChI=1S/C10H4ClF2N3O3/c11-9-8(16(17)18)10(15-4-14-9)19-7-3-5(12)1-2-6(7)13/h1-4H |
| InChIKey | HWJBFGRTJSIOOW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|