C13H9BrF3NO2 — CID 107097473
2-(5-bromo-2,3-difluorophenoxy)-5-fluoro-4-methoxyaniline (PubChem CID 107097473) has the molecular formula C13H9BrF3NO2 and a molecular weight of 348.12 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenoxy)-5-fluoro-4-methoxyaniline.
| Compound Name | 2-(5-bromo-2,3-difluorophenoxy)-5-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 107097473 |
| Molecular Formula | C13H9BrF3NO2 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenoxy)-5-fluoro-4-methoxyaniline |
| SMILES | COc1cc(Oc2cc(Br)cc(F)c2F)c(N)cc1F |
| InChI | InChI=1S/C13H9BrF3NO2/c1-19-10-5-11(9(18)4-7(10)15)20-12-3-6(14)2-8(16)13(12)17/h2-5H,18H2,1H3 |
| InChIKey | GLOIQZLENGZGGL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|