C15H16FNO2 — CID 63599666
2-(3,4-dimethylphenoxy)-5-fluoro-4-methoxyaniline (PubChem CID 63599666) has the molecular formula C15H16FNO2 and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-5-fluoro-4-methoxyaniline.
| Compound Name | 2-(3,4-dimethylphenoxy)-5-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 63599666 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-5-fluoro-4-methoxyaniline |
| SMILES | COc1cc(Oc2ccc(C)c(C)c2)c(N)cc1F |
| InChI | InChI=1S/C15H16FNO2/c1-9-4-5-11(6-10(9)2)19-15-8-14(18-3)12(16)7-13(15)17/h4-8H,17H2,1-3H3 |
| InChIKey | ZDTVAKSFZDRJCT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|