C13H11F2N5O — CID 114787415
6-(3,4-difluorophenoxy)-N-ethyl-7H-purin-2-amine (PubChem CID 114787415) has the molecular formula C13H11F2N5O and a molecular weight of 291.26 g/mol. Its IUPAC name is 6-(3,4-difluorophenoxy)-N-ethyl-7H-purin-2-amine.
| Compound Name | 6-(3,4-difluorophenoxy)-N-ethyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114787415 |
| Molecular Formula | C13H11F2N5O |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 6-(3,4-difluorophenoxy)-N-ethyl-7H-purin-2-amine |
| SMILES | CCNc1nc(Oc2ccc(F)c(F)c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H11F2N5O/c1-2-16-13-19-11-10(17-6-18-11)12(20-13)21-7-3-4-8(14)9(15)5-7/h3-6H,2H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | YIZIKNGPDIWPKE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |