C13H11BrFN5O — CID 114788114
6-(5-bromo-2-fluorophenoxy)-N-ethyl-7H-purin-2-amine (PubChem CID 114788114) has the molecular formula C13H11BrFN5O and a molecular weight of 352.17 g/mol. Its IUPAC name is 6-(5-bromo-2-fluorophenoxy)-N-ethyl-7H-purin-2-amine.
| Compound Name | 6-(5-bromo-2-fluorophenoxy)-N-ethyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788114 |
| Molecular Formula | C13H11BrFN5O |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 6-(5-bromo-2-fluorophenoxy)-N-ethyl-7H-purin-2-amine |
| SMILES | CCNc1nc(Oc2cc(Br)ccc2F)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H11BrFN5O/c1-2-16-13-19-11-10(17-6-18-11)12(20-13)21-9-5-7(14)3-4-8(9)15/h3-6H,2H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | CDCATYJDBCCJOZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |