C18H19ClN6OS — CID 40900749
(2R)-2-[(2-chloro-7H-purin-6-yl)sulfanyl]-1-(4-phenylpiperazin-1-yl)propan-1-one (PubChem CID 40900749) has the molecular formula C18H19ClN6OS and a molecular weight of 402.91 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-7H-purin-6-yl)sulfanyl]-1-(4-phenylpiperazin-1-yl)propan-1-one.
| Compound Name | (2R)-2-[(2-chloro-7H-purin-6-yl)sulfanyl]-1-(4-phenylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 40900749 |
| Molecular Formula | C18H19ClN6OS |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (2R)-2-[(2-chloro-7H-purin-6-yl)sulfanyl]-1-(4-phenylpiperazin-1-yl)propan-1-one |
| SMILES | C[C@@H](Sc1nc(Cl)nc2nc[nH]c12)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H19ClN6OS/c1-12(27-16-14-15(21-11-20-14)22-18(19)23-16)17(26)25-9-7-24(8-10-25)13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3,(H,20,21,22,23)/t12-/m1/s1 |
| InChIKey | DWEYXIGIHYSMMU-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |